Potassium rhodizonate
Potassium rhodizonate (3,4,5,6-Tetraoxocyclohexene-1,2-diol dipotassium salt, Rhodizonic acid potassium salt), a benzoquinone derivative, is the potassium salt of rhodizonic acid. Its crystalline structure has been reported and it exhibits space group Fddd. Rhodizonate dianion undergoes various thermal and photochemical reactions with various oxidizing reagents in aqueous solution.
| Catalog Number | CBB1118253 |
| Alternative Name(s) | Rhodizonic acid potassium salt; 3,4,5,6-Tetraoxocyclohexene-1,2-diol dipotassium salt |
| Molecular Formula | C6O6K2 |
| CAS# | 13021-40-4 |
| Purity | >85% |
| Inchi | 1S/C6H2O6.2K/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h7-8H;;/q;2*+1/p-2 |
| Inchi Key | NEWIILAQDSMNML-UHFFFAOYSA-L |
| SMILES | [K+].[K+].[O-]C1=C([O-])C(=O)C(=O)C(=O)C1=O |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/potassium-rhodizonate-item-118253.html |