Latanoprost (Standard) | MedChemExpress (MCE)
Latanoprost (Standard) is the analytical standard of Latanoprost. This product is intended for research and analytical applications. Latanoprost (PHXA41) is a prostaglandin F2α analogue and an agonist for the FP prostanoid receptor, and lowers intraocular-pressure (IOP).
| Trivial name | Latanoprost (Standard) |
| Catalog Number | HY-B0577R |
| Alternative Name(s) | PHXA41 (Standard) |
| Research Area | Others |
| CAS# | 130209-82-4 |
| Purity | ≥98.00% |
| SMILES | O=C(OC(C)C)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCC2=CC=CC=C2)[C@H](O)C[C@@H]1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/latanoprost-standard.html |