(Trp63,Trp64)-C3a(63-77) | MedChemExpress (MCE)
(Trp63,Trp64)-C3a(63-77) is a C3a synthetic analogue peptide, which exhibits Ca2+ stimulating efficacy in human neutrophils and hC3aR or mC3aR expressing RBL-2H3 cells with EC50 of 9.5, 2.0 and 0.8 nM, respectively[1].
| Trivial name | (Trp63,Trp64)-C3a(63-77) |
| Catalog Number | HY-P1640 |
| Research Area | Inflammation/Immunology |
| CAS# | 130154-64-2 |
| Purity | ≥98.0% |
| SMILES | N[C@@H](CC1=CNC2=CC=CC=C12)C(N[C@H](C(NCC(N[C@@H](CCCCN)C(N[C@@H](CCCCN)C(N[C@H](C(N[C@@H](CCCNC(N)=N)C(N[C@@H](C)C(N[C@@H](CO)C(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(NCC(N[C@@H](CC(C)C)C(N[C@@H](C)C(N[C@H](C(O)=O)CCCNC(N)=N)=O)=O)=O)=O)=O)=O)=O)=O)=O)CC3=CC=C(C=C3)O)=O)=O)=O)=O)CC4=CNC5=CC=CC=C45)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/trp63-trp64-c3a-63-77.html |