Mafenide Acetate
Mafenide Acetate is a synthetic sulfonamide-derived with topical anti-infective activity, which acts through competition with PABA for the bacterial enzyme dihydropteroate synthase and thereby interfering with normal folic acid metabolism.
| Trivial name | / |
| Catalog Number | CSN11352 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C9H14N2O4S |
| CAS# | 13009-99-9 |
| Purity | ≥98% |
| SMILES | O=S(C1=CC=C(CN)C=C1)(N)=O.CC(O)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/mafenide-acetate.html |
