NQ301
NQ301, a selective CD45 inhibitor with an IC50 of 200 nM, is also an antithrombotic agent and inhibits collagen-challenged rabbit platelet aggregation with an IC50 of 10 mg/mL.
| Trivial name | / |
| Catalog Number | CSN19097 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease|Infection |
| Molecular Formula | C18H12ClNO3 |
| CAS# | 130089-98-4 |
| Purity | ≥98% |
| SMILES | O=C1C(NC2=CC=C(C(C)=O)C=C2)=C(Cl)C(C3=C1C=CC=C3)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/nq301.html |
