I-BET151 (GSK1210151A)
Selective BET inhibitor Chromatin/Epigenetics|Bromodomain
| Catalog Number | B1500-5 |
| Research Area | Chromatin/Epigenetics|Bromodomain |
| Molecular Formula | C23H21N5O3 |
| CAS# | 1300031-49-5 |
| Purity | 98.12% |
| SMILES | CC1=C(C(=NO1)C)C2=C(C=C3C(=C2)N=CC4=C3N(C(=O)N4)C(C)C5=CC=CC=N5)OC |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1500 |
