Riboflavin phosphate sodium
Flavin mononucleotide (riboflavin-5′-phosphate, FMN) is a biomolecule produced from riboflavin (vitamin B2) by the enzyme riboflavin kinase and functions as prosthetic group of various oxidoreductases including NADH dehydrogenase as well as cofactor in biological blue-light photo receptors.
| Trivial name | Flavin mononucleotide, riboflavin-5'-phosphate, FMN, Vitamin B2 Phosphate Sodium Salt |
| Catalog Number | S5107 |
| Molecular Formula | C21H24O9 |
| CAS# | 130-40-5 |
| Inchi | InChI=1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1 |
| Inchi Key | GKAJCVFOJGXVIA-DXKBKAGUSA-N |
| SMILES | COC1=C(C=C(C=C1)C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/flavin-mononucleotide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/flavin-mononucleotide-chemical-structure-s5107.gif |
