Phytic acid dipotassium salt
Phytic acid dipotassium salt (Phytic acid potassium, IP6 (PS)), an endogenous metabolite in rice grain extract and digest, inhibits β-secretase 1 (BACE1) with IC50 of approximately 0.25 μM.
| Trivial name | Phytic acid potassium, IP6 (PS) |
| Catalog Number | S3326 |
| Molecular Formula | C6H16K2O24P6 |
| CAS# | 129832-03-7 |
| SMILES | [K+].[K+].O[P](O)(=O)OC1C(O[P](O)(O)=O)C(O[P](O)(O)=O)C(O[P]([O-])([O-])=O)C(O[P](O)(O)=O)C1O[P](O)(O)=O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/phytic-acid-dipotassium-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3326-phytic-acid-dipotassium-salt-chemical-structure.gif |