Y-27632 2HCl
Y-27632 2HCl is a selective ROCK1 and ROCK2 inhibitor with a Ki of 140 nM and 300nM in a cell-free assay, exhibits >200-fold selectivity over other kinases, including PKC, cAMP-dependent protein kinase, MLCK and PAK.
| Trivial name | N/A |
| Catalog Number | S1049 |
| Molecular Formula | C20H6I4Na2O5 |
| CAS# | 129830-38-2 |
| Inchi | InChI=1S/C20H8I4O5.2Na/c21-11-5-9-17(13(23)15(11)25)28-18-10(6-12(22)16(26)14(18)24)20(9)8-4-2-1-3-7(8)19(27)29-20;;/h1-6,25-26H;;/q;2*+1/p-2 |
| Inchi Key | RAGZEDHHTPQLAI-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)I)[O-])I)I)[O-])I.[Na+].[Na+] |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/Y-27632.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Y-27632-2HCL-chemical-structure-s1049.gif |