Aripiprazole (1042634)
USP Standards
| Trivial name | NULL |
| Catalog Number | CS-EB-02311 |
| Alternative Name(s) | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one; 7-[4-[4-(2,3-Dichlorophenyl)-1-piperazinyl]butoxy]-3,4-dihydro-2(1H)-quinolinone; 7-[4-[4-(2,3-Dichlorophenyl)-1-piperazinyl]butoxy]-3,4-dihydrocarbostyril; Abilify; Abilitat; OPC 14597; OPC 31; |
| Research Area | Aripiprazole is an agonist at the dopamine autoreceptor and an antagonist at the postsynaptic D2 receptor (1,2,3,4). Aripiprazole is an antipsychotic and a potential drug candidate for treating psychoses such as schizophrenia |
| Molecular Formula | C23H27Cl2N3O2 |
| CAS# | 129722-12-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C1CC(=O)NC2=C1C=CC(=C2)OCCCCN3CCN(CC3)C4=C(C(=CC=C4)Cl)Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSEB02311.html |
| Additional Information | NULL |