Verteporfin
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30817 |
| Alternative Name(s) | (4R,4aS)-rel-24H,26H-Benzo[b]porphine-9,13-dipropanoc cid 18-ethenyl-4,4a-dihydro-3,4-bis(methoxcarbonyl)-4a,8,14,19-tetramethyl-monomethyl Ester 22,23‐bis(methtetramethyl‐ 25,26,27,28-tetraazah⁶ctcosa‐1(25),2,4,6,8(27),9,11,13,15,17,19,21‐dodcaen‐9‐yl]propanoc cid. |
| Research Area | Verteporfin, otherwise known as benzoporphyrin derivative (trade name Visudyne�), is a medication used as a photosensitizer for photodynamic therapy to eliminate the abnormal blood vessels in the eye associated with conditions such as the wet form of macu |
| Molecular Formula | C41H42N4O8 |
| CAS# | 129497-78-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]1(/C2=C/C(N3)=C4C)C(C(/C=C(C(C)=C/5C=C)NC5=C/C6=N/C(C(CCC(O)=O)=C6C)=CC3=C4CCC(OC)=O)=N2)=CC=C(C(OC)=O)[C@H]1C(OC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30817.html |
| Additional Information | NULL |