Verteporfin 10mM * 1mL in DMSO
Verteporfin is a benzoporphyrin derivative and is a medication used as a photosensitizer for photodynamic therapy to eliminate the abnormal blood vessels in the eye associated with conditions such as the wet form of macular degeneration.
| Trivial name | Verteporfin 10mM * 1mL in DMSO |
| Catalog Number | A12658-10mM-D |
| Alternative Name(s) | trans-3,4-Dicarboxy-4,4a-dihydro-4a,8,14,19-tetramethyl-18-vinyl-23H,25H-benzo(b)porphine-9,13-dipropionic acid 3,4,9-trimethyl ester |
| Molecular Formula | C41H42N4O8 |
| CAS# | 129497-78-5 |
| SMILES | CC1=C(C2=CC3=NC(=CC4=C(C(=C(N4)C=C5C6(C(C(=CC=C6C(=N5)C=C1N2)C(=O)OC)C(=O)OC)C)C)CCC(=O)OC)C(=C3C)CCC(=O)O)C=C.CC1=C(C2=CC3=NC(=CC4=C(C(=C(N4)C=C5C6(C(C(=CC=C6C(=N5)C=C1N2)C(=O)OC)C(=O)OC)C)C)CCC(=O)O)C(=C3C)CCC(=O)OC)C=C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/verteporfin.html |