Fulvestrant (Faslodex) 10mM * 1mL in DMSO
Fulvestrant is an estrogen receptor antagonist with no agonist effects, which works both by down-regulating and by degrading the estrogen receptor.
Trivial name | Fulvestrant (Faslodex) 10mM * 1mL in DMSO |
Catalog Number | A10410-10mM-D |
Alternative Name(s) | (7??,17??)-7-{9-[(4,4,5,5,5-pentafluoropentyl)sulfinyl]nonyl}estra-1,3,5(10)-triene-3,17-diol |
Molecular Formula | C32H47F5O3S |
CAS# | 129453-61-8 |
SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)[C@@H](CC4=C3C=CC(=C4)O)CCCCCCCCCS(=O)CCCC(C(F)(F)F)(F)F |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/fulvestrant-faslodex.html |