Methylephedrine d3 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11115 |
| Alternative Name(s) | (1S,2R)-2-[(D3)methyl(methyl)amino]-1- phenylpropan-1-olhydrochloride |
| Research Area | Labeled ephedrine, intended for use as an internal standard for the quantification of ephedrine by GC- or LC-mass spectrometry. |
| Molecular Formula | C11H15D3ClNO |
| CAS# | 1292841-87-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C1=CC=CC=C1)[C@@H](C)N(C)C([2H])([2H])[2H].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11115.html |
| Additional Information | NULL |