Hoechst 33258 analog 6 100mg
Hoechst 33258 analog 6 is a anglog of Hoechst stains(Hoechst 33258), which are part of a family of blue fluorescent dyes used to stain DNA.
| Trivial name | Hoechst 33258 analog 6 100mg |
| Catalog Number | A15111-100 |
| Alternative Name(s) | 2, 6-ditert-butyl-4-[5-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1, 3-dihydrobenzimidazol-2-ylidene]cyclohexa-2, 5-dien-1-one |
| Molecular Formula | C33H40N6O |
| CAS# | 129244-66-2 |
| SMILES | CC(C)(C)C1=CC(=C2NC3=C(N2)C=C(C=C3)C4=NC5=C(N4)C=C(C=C5)N6CCN(CC6)C)C=C(C1=O)C(C)(C)C |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/hoechst-33258-analog-6.html |