(+)-ε-Viniferin | MedChemExpress (MCE)
(+)-ε-Viniferin is a stilbenes compound with PGE2 inhibition effect, and is an orally active anti-inflammatory agent. ε-viniferin is also able to reduce fat accumulation, thus can be used for research of inflammation or obesity[1][2].
| Trivial name | (+)-ε-Viniferin |
| Catalog Number | HY-N10755 |
| Research Area | Metabolic Disease; Inflammation/Immunology |
| CAS# | 129170-22-5 |
| Purity | ≥98.00% |
| SMILES | OC(C=C1)=CC=C1/C=C/C2=C3[C@H](C4=CC(O)=CC(O)=C4)[C@@H](C5=CC=C(C=C5)O)OC3=CC(O)=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/plus-ε-viniferin.html |