ENMD-2076 L-(+)-Tartaric acid
ENMD-2076 L-(+)-Tartaric acid is the tartaric acid of ENMD-2076, selective activity against Aurora A and Flt3 with IC50 of 14 nM and 1.86 nM, 25-fold more selective for Aurora A than Aurora B and less potent to VEGFR2/KDR and VEGFR3, FGFR1 and FGFR2 and PDGFRα. Phase 2.
| Trivial name | N/A |
| Catalog Number | S2018 |
| Molecular Formula | C17H13N5 |
| CAS# | 1291074-87-7 |
| Inchi | InChI=1S/C17H13N5/c1-11-4-2-5-16(20-11)17-12(10-19-22-17)13-7-8-14-15(21-13)6-3-9-18-14/h2-10H,1H3,(H,19,22) |
| Inchi Key | LBPKYPYHDKKRFS-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=C(C=NN2)C3=NC4=C(C=C3)N=CC=C4 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/enmd-2076-l-tartaric-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/ENMD-2076-L-Tartaric-acid-chemical-structure-s2018.gif |
