SP600125 10mM * 1mL in DMSO
SP600125 is a JNK inhibitor with IC50=40 nM for JNK-1 and JNK-2 and 90 nM for JNK-3.
Trivial name | SP600125 10mM * 1mL in DMSO |
Catalog Number | A10860-10mM-D |
Alternative Name(s) | 1,9-Pyrazoloanthrone |
Molecular Formula | C14H8N2O |
CAS# | 129-56-6 |
SMILES | C1=CC=C2C(=C1)C3=NNC4=CC=CC(=C43)C2=O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/sp600125.html |