Clarithromycin EP impurity F
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-57950 |
| Alternative Name(s) | Clarithromycin EP impurity F;12-O-Methrythrethylerythromycin A;6,12-Di-O-methylerythromycin A;12-O-Methrythrethylerythromycin A; 128940-83-0 |
| Research Area | 12-O-Methyl Clarithromycin is a methylated impurity of the semi-synthetic macrolide antibiotic Clarithromycin (C559750). 12-O-Methyl Clarithromycin was shown to inhibit uptake of Clarithromycin into the lung cells. |
| Molecular Formula | C39H71NO13 |
| CAS# | 128940-83-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]([C@@H]([C@H](C(O[C@@H]1CC)=O)C)O[C@@](O[C@@H](C)[C@@H]2O)([H])C[C@@]2(C)OC)[C@H]([C@@](C)(C[C@H](C([C@@H]([C@@H](O)[C@]1(C)OC)C)=O)C)OC)O[C@@](O[C@H](C)C[C@@H]3N(C)C)([H])[C@@H]3O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57950.html |
| Additional Information | NULL |