16-HETE | MedChemExpress (MCE)
16-HETE is arachidonic acid metabolite through subterminal hydroxylation by cytochrome P-450. 16-HETE exhibits vasodilatory and PMN inhibitory effects and serves as biomarker for early stages of non-alcoholic fatty liver disease[1][2][3].
| Trivial name | 16-HETE |
| Catalog Number | HY-116444A |
| Research Area | Inflammation/Immunology; Cardiovascular Disease |
| CAS# | 128914-46-5 |
| Purity | ≥98.0% |
| SMILES | CCCCC(O)/C=C\C/C=C\C/C=C\C/C=C\CCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/16-hete.html |