Ospemifene
API Standards
| Trivial name | NULL |
| Catalog Number | CS-T-38124 |
| Alternative Name(s) | Fc 1271;2-[4-[(1Z)phenoxy]-ethanol |
| Research Area | Ospemifene is used to treat dyspareunia. It is a selective estrogen receptor modulator (SERM) acting similarly to an estrogen. |
| Molecular Formula | C24H23ClO2 |
| CAS# | 128607-22-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClCC/C(C1=CC=CC=C1)=C(C2=CC=CC=C2)/C3=CC=C(OCCO)C=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST38124.html |
| Additional Information | NULL |