GSK2578215A 10mM * 1mL in DMSO
GSK2578215A is a potent leucine-rich repeat kinase 2 (LRRK2) inhibitor (IC50 values are 8.9 and 10.1 nM respectively for LRRK2[G2019S] mutant and wild-type LRRK2 respectively).
Trivial name | GSK2578215A 10mM * 1mL in DMSO |
Catalog Number | A12798-10mM-D |
Alternative Name(s) | 5-(2-Fluoro-4-pyridinyl)-2-(phenylm?ethoxy)-N-3-pyridinylbenzamide |
Molecular Formula | C24H18FN3O2 |
CAS# | 1285515-21-0 |
SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=CC(=NC=C3)F)C(=O)NC4=CN=CC=C4 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/gsk2578215a.html |