Romidepsin (FK228 ,Depsipeptide) 5mg
Romidepsin strongly inhibits HDAC1 and HDAC2 with IC5N/A of 1.6 nM and 3.9 nM, respectively, but is relatively weak in inhibiting HDAC4 and HDAC6 with IC5N/A 25 nM and 79N/A nM, respectively.
| Trivial name | Romidepsin (FK228 ,Depsipeptide) 5mg |
| Catalog Number | A11920-5 |
| Alternative Name(s) | Cyclo[(2Z)-2-amino-2-butenoyl-L-valyl-(3S,4E)-3-hydroxy-7-mercapto-4-heptenoyl-D-valyl-D-cysteinyl], cyclic (3-5)-disulfide |
| Molecular Formula | C24H36N4O6S2 |
| CAS# | 128517-07-7 |
| SMILES | C/C=C1/C(=O)N[C@H](C(=O)O[C@H]2CC(=O)N[C@@H](C(=O)N[C@H](CSSCC/C=C2)C(=O)N1)C(C)C)C(C)C |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/romidepsin-fk228-depsipeptide.html |
