DMT-2′-O-Me-G(dmf)-CE Phosphoramidite
2′-OMe-dmf-G-CE Phosphoramidite, a vital compound in the biomedicine industry, is leveraged for the crucial synthesis of oligonucleotides. These tiny yet potent molecules are widely utilized in treating an array of afflictions such as cancer, viral infections, and genetic disorders. Devised to heighten the steadfastness and efficacy of oligonucleotides, our product offers patients the potential for better therapeutic outcomes.
| Catalog Number | PIPB-0310 |
| Alternative Name(s) | (2R,3R,4R,5R)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-5-(2-(((dimethylamino)methylene)amino)-6-oxo-1,6-dihydro-9H-purin-9-yl)-4-methoxytetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite 2'-O-METHYL-N2-DIMETHYLFORMAMIDE-5'-O-DMT-GUANOSINE-3'-CE-PHOSPHORAMIDITE MFCD29904574 A907898 |
| Research Area | Phosphoramidites Series |
| Molecular Formula | C44H55N8O8P |
| CAS# | 128219-77-2 |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OC)N2C=NC3=C2N=C(NC3=O)N=CN(C)C)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dmt-2-o-me-gdmf-ce-phosphoramidite-item-10428.html |