Ursodeoxycholic acid
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30812 |
| Alternative Name(s) | Ursodiol;(R)-4-((3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethylhexadcahydro-1Hcclopenta[a]phenanthren-17-yl)pentanoc cid |
| Research Area | Used as an anticholelithogenic. Epimer with Chenodiol with respect to the hydroxyl group at C7. |
| Molecular Formula | C24H40O4 |
| CAS# | 128-13-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2([H])[C@H](C)CCC(O)=O)[C@](CC2)([H])[C@@]([C@H](C[C@]3([H])C[C@H](O)CC4)O)([H])[C@]([C@]34C)([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30812.html |
| Additional Information | NULL |