Raloxifene 4′-glucuronide-d4 | MedChemExpress (MCE)
Raloxifene 4′-glucuronide-d4 is deuterated labeled Raloxifene 4′-glucuronide (HY-135582). Raloxifene 4′-glucuronide is a primary metabolite of Raloxifene. Raloxifene 4′-glucuronide formation is mediated mostly by UGT1A10 and UGT1A8. Raloxifene 4′-glucuronide binds to estrogen receptor with an IC50 of 370 μM. [1][2]. Raloxifene is a selective estrogen receptor modulator. Raloxifene activates TGFβ3 promoter as a full agonist at nanomolar concentrations, and inhibits the estrogen response element-containing vitellogenin promoter expression[3].
| Trivial name | Raloxifene 4'-glucuronide-d4 |
| Catalog Number | HY-135582S |
| Research Area | Endocrinology |
| CAS# | 1279033-52-1 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC=C(C=C1)OC([2H])([2H])C([2H])([2H])N2CCCCC2)C3=C(C4=CC=C(C=C4)O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)C(O)=O)SC6=CC(O)=CC=C63 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/raloxifene-4-glucuronide-d4.html |