4-Hydroxy Atorvastatin D5 Disodium Salt
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02780 |
| Alternative Name(s) | Sodium (3R,5R)-7-(2-(4-fluorophenyl)-5-isopropyl-4-((4-oxidophen1-yl)-3,5-dihydroxyheptanoate |
| Research Area | A labeled metabolite of Atorvastatin,;Labeled Atorvastatin, intended for use as an internal standard for the quantification of Atorvastatin by GC- or LC-mass spectrometry. |
| Molecular Formula | C33H28D5FN2Na2O6 |
| CAS# | 1276537-18-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H](CCN1C(C2=CC=C(C=C2)F)=C(C(C(NC3=CC=C(C=C3)[O-])=O)=C1C(C)C)C4=C(C([2H])=C(C([2H])=C4[2H])[2H])[2H])C[C@H](CC([O-])=O)O.[Na+].[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02780.html |
| Additional Information | NULL |