Sivelestat
Sivelestat is a competitive inhibitor of human neutrophil elastase(IC50 = 44 nM and Ki=200 nM) and also inhibits leukocyte elastase obtained from rabbit, rat, hamster and mouse.
| Trivial name | ONO-5046; LY-544349; EI-546 |
| Catalog Number | CSN18744 |
| Alternative Name(s) | ONO-5046; LY-544349; EI-546 |
| Research Area | / |
| Molecular Formula | C20H22N2O7S |
| CAS# | 127373-66-4 |
| Purity | ≥98% |
| SMILES | O=C(O)CNC(C1=CC=CC=C1NS(=O)(C2=CC=C(OC(C(C)(C)C)=O)C=C2)=O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/sivelestat.html |