Sivelestat 25mg
Sivelestat is a cell-permeable sulfanilide compound that acts as a potent, substrate-competitive, and highly specific inhibitor of neutrophil elastase (IC50 = 19-49 nM in rat, rabbit, hamster, human, and mouse leukocyte elastase).
| Trivial name | Sivelestat 25mg |
| Catalog Number | A14184-25 |
| Alternative Name(s) | N-(2-(((4-(2,2-Dimethyl-1-oxopropoxy)phenyl)sulfonyl)amino)benzoyl)glycine |
| Molecular Formula | C20H22N2O7S |
| CAS# | 127373-66-4 |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/sivelestat.html |
