Clarithromycin EP impurity C
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-11824 |
| Alternative Name(s) | Clarithromycin E-9-Oxime; Clarithromycin (9E)-Oxime; 6-O-Methylerythromycin 9-Oxime; 6-O-Methylerythromycin A 9-Oxime |
| Research Area | Impurity in commercial preparations of Clarithromycin. It is an impurity of Clarithromycin, a macrolide antibiotic. |
| Molecular Formula | C38H70N2O13 |
| CAS# | 127253-06-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](OC)(C[C@H](C([C@@H]1C)=NO)C)[C@@H]([C@H]([C@]([C@H](C(O[C@H](CC)[C@@](C)(O)[C@@H]1O)=O)C)([H])O[C@@](O[C@@H](C)[C@@H]2O)([H])C[C@@]2(C)OC)C)O[C@@](O[C@H](C)C[C@@H]3N(C)C)([H])[C@@H]3O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11824.html |
| Additional Information | NULL |