Corticosterone D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-51261 |
| Alternative Name(s) | 17-Deol-3,20-dione-d;(11b)-11,21-Dihydroxy-pregn-4-ene-3,20-dione-d8; 11,21-Dihydroxyprogesterone-d8; 17-Deol-3,20-dione-d; Kendalls compound B-d8; NSC 9705-d8; |
| Research Area | Labelled Corticosterone . Glucocorticoid; an intermediate in the biosynthesis of aldosterone, isolated from the adrenal cortex. |
| Molecular Formula | C21H22D8O4 |
| CAS# | 1271728-07-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](C(C([2H])([2H])C1)=C2[2H])(CC([2H])([2H])C2=O)[C@]3([H])[C@]1([H])[C@@](CC[C@]4([2H])C(C([2H])([2H])O)=O)([H])[C@]4(C)C[C@@H]3O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST51261.html |
| Additional Information | NULL |