α-Cetone | MedChemExpress (MCE)
Isonaline 70 is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | α-Cetone |
| Catalog Number | HY-W127740 |
| Alternative Name(s) | Isomethyl-α-ionone; α-Isomethylionone |
| Research Area | Others |
| CAS# | 127-51-5 |
| Purity | ≥98.00% |
| SMILES | CC1=CCCC(C)(C)C1C=C(C)C(=O)C |
| PubChem Chemical Structure ID | 5372174 |
| Size | 5 g |
| Supplier Page | https://www.medchemexpress.com/α-cetone.html |