Selexipag D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16227 |
| Alternative Name(s) | 2-{4-[(5,6-diphenylpyrazin-2-yl)[(1,1,1,2,3,3,3-D7)propan-2-yl]amino]butoxy}-N-methanesulfonylacetamide |
| Research Area | Labeled Selexipag, intended for use as an internal standard for the quantification of Selexipag by GC- or LC-mass spectrometry. |
| Molecular Formula | C26H25D7N4O4S |
| CAS# | 1265295-21-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N[S](C)(=O)=O)COCCCCN(C1=CN=C(C2=CC=CC=C2)C(C3=CC=CC=C3)=N1)C(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16227.html |
| Additional Information | NULL |