Zoligratinib (Debio-1347)
Zoligratinib (Debio-1347, CH5183284, FF284) is a selective and orally available FGFR inhibitor with IC50 of 9.3 nM, 7.6 nM, 22 nM, and 290 nM for FGFR1, FGFR2, FGFR3, and FGFR4, respectively. Phase 1.
| Trivial name | CH5183284, FF284 |
| Catalog Number | S7665 |
| Molecular Formula | C20H16N6O |
| CAS# | 1265229-25-1 |
| Inchi | InChI=1S/C20H16N6O/c1-11-23-16-7-6-13(9-17(16)24-11)26-20(21)14(10-22-26)19(27)18-8-12-4-2-3-5-15(12)25-18/h2-10,25H,21H2,1H3,(H,23,24) |
| Inchi Key | BEMNJULZEQTDJY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)N3C(=C(C=N3)C(=O)C4=CC5=CC=CC=C5N4)N |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/ch5183284-debio-1347.html |
| Additional Information | https://file.selleck.cn/downloads/struct/ch5183284-debio-1347-chemical-structure-s7665.gif |