BCN-OH | MedChemExpress (MCE)
BCN-OH (endo-9-Hydroxymethylbicyclo[6.1.0]non-4-yne) is a mitochondrial probe based on the lyophilic bidentate bicyclic ligand BCN and is a control reagent for BCN-TPP. The TPP group is a reactive sulfenic acid probe that targets mitochondria. BCN-TPP is known to affect mitochondrial energy, causing a sharp decrease in basal respiration, causing it to exhibit faster reaction kinetics with sulfonated proteins. BCN-OH does not contain hydrophobic triphenylphosphonium (TPP) ions. Using BCN-OH as a control allows the TPP group to be safely introduced when designing sulfenic acid traps[1].
Trivial name | BCN-OH |
Catalog Number | HY-W111141 |
Alternative Name(s) | endo-9-Hydroxymethylbicyclo[6.1.0]non-4-yne |
Research Area | Others |
CAS# | 1263166-90-0 |
Purity | 99.2% |
SMILES | [H][C@]12[C@@]([H])([C@@H]2CO)CCC#CCC1 |
Size | 100 mg |
Supplier Page | https://www.medchemexpress.com/bcn-oh.html |