Mycophenolic Acid 13C D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-01192 |
| Alternative Name(s) | (4E)-6-[4-hydroxy-6-(13C,D3)methoxy-7-methyl-3-oxo-1,3-dihydro-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| Research Area | Labeled Mycophenolate, intended for use as an internal standard for the quantification of Mycophenolate by GC- or LC-mass spectrometry. |
| Molecular Formula | C16[13C]H17D3O6 |
| CAS# | 1261432-16-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(COC2=O)C2=C(O)C(C/C=C(C)/CCC(O)=O)=C1O[13C]([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01192.html |
| Additional Information | NULL |