N-O-Didesmethyl Tramadol D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-07026 |
| Alternative Name(s) | Rac N-O-Didesmethyl Tramadol D3;rel-3-[(1R,2R)-1-Hydroxy-2-[(methyl-d3-amino)methyl]cyclohexyl]phenol ; cis-(+/-)-3-[1-Hydroxy-2-[(methyl-d3-amino)methyl]cyclohexyl]phenol ; Di-N,O-demethyltramadol-d3; 3-[(1R,2R)-1-hydroxy-2- {[(D3)methylamino]methyl}cyclohexyl]phenol |
| Research Area | Labeled Tramadol, intended for use as an internal standard for the quantification of Tramadol by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H18D3NO2 |
| CAS# | 1261398-22-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](CCCC1)(C2=CC(O)=CC=C2)[C@H]1CNC([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07026.html |
| Additional Information | NULL |