Donepezil D7 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06560 |
| Alternative Name(s) | 2-((1-benzyl D7 piperidin-4-yl)methyl)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-one;2,3-Dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methyl]-1H-inden-1-one-d7 Hydrochloride; Aricept-d7; Aricept D-d7 |
| Research Area | Labeled Donepezil, intended for use as an internal standard for the quantification of Donepezilby GC- or LC-mass spectrometry. |
| Molecular Formula | C24H23D7ClNO3 |
| CAS# | 1261394-20-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=CC(OC)=C(OC)C=C2CC1CC3CCN(C([2H])([2H])C(C([2H])=C4[2H])=C(C([2H])=C4[2H])[2H])CC3.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06560.html |
| Additional Information | NULL |