LLL12 | MedChemExpress (MCE)
LLL12 is a small molecule inhibitor of STAT3 that inhibits STAT3 phosphorylation. LLL12 enhanced the inhibitory effect of Cisplatin (HY-17394) and Paclitaxel (HY-B0015) on ovarian cancer cell formation, migration, and growth[1].
| Trivial name | LLL12 |
| Catalog Number | HY-19536 |
| Research Area | Cancer |
| CAS# | 1260247-42-4 |
| Purity | 98.00% |
| SMILES | O=S(C(C=CC=C1C(C2=C3C=CC=C2O)=O)=C1C3=O)(N)=O |
| PubChem Chemical Structure ID | 46911017 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/lll12.html |