Sarsasapogenin 100mg
Sarsasapogenin is a steroidal sapogenin, that is the aglycosidic portion of a plant saponin. Sarsasapogenin and its C-25 epimer smilagenin lowered blood sugar and reversed diabetic weight gain in experiments within mice with a mutant diabetes gene (db).
| Trivial name | Sarsasapogenin 100mg |
| Catalog Number | A12116-100 |
| Alternative Name(s) | N/A |
| Molecular Formula | C27H44O3 |
| CAS# | 126-19-2 |
| SMILES | C[C@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@H]6[C@@]5(CC[C@@H](C6)O)C)C)C)OC1 |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/sarsasapogenin.html |
