Malachite Green D5 Picrate
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00226 |
| Alternative Name(s) | 4-{[4-(dimethylamino)phenyl](H)phenylmethylidene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium 2,4,6-trinitrobenzen-1-olate |
| Research Area | Labeled Malachite Green, intended for use as an internal standard for the quantification of Malachite Green by GC- or LC-mass spectrometry. |
| Molecular Formula | C29D5H22N5O7 |
| CAS# | 1258668-21-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[N](C(C=C([N](=O)=O)C=C1[N](=O)=O)=C1[O-])=O.CN(C)C2=CC=C(C=C2)/C(C(C([2H])=C3[2H])=C(C([2H])=C3[2H])[2H])=C(C=C/4)C=CC4=[N+](C)/C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00226.html |
| Additional Information | NULL |