ABT-199 10mM * 1mL in DMSO
ABT-199 is a so-called BH3-mimetic drug, which is designed to block the function of the protein Bcl 2.
| Trivial name | ABT-199 10mM * 1mL in DMSO |
| Catalog Number | A12500-10mM-D |
| Alternative Name(s) | 4-(4-{[2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-en-1-yl]methyl}piperazin-1-yl)-N-({3-nitro-4-[(tetrahydro-2H-pyran-4-ylmethyl)amino]phenyl}sulfonyl)-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| Molecular Formula | C45H50ClN7O7S |
| CAS# | 1257044-40-8 |
| SMILES | CC1(CCC(=C(C1)C2=CC=C(C=C2)Cl)CN3CCN(CC3)C4=CC(=C(C=C4)C(=O)NS(=O)(=O)C5=CC(=C(C=C5)NCC6CCOCC6)[N+](=O)[O-])OC7=CN=C8C(=C7)C=CN8)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/abt-199.html |