Sofosbuvir metabolite GS-566500 13CD3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-30478 |
| Alternative Name(s) | NULL |
| Research Area | Labeled metabolite of Sofosbuvir, intended for use as an internal standard for the quantification of Sofosbuvir by GC- or LC-mass spectrometry. |
| Molecular Formula | C12(13C)H16D3FN3O9P |
| CAS# | 1256490-46-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | F[C@]1([C@H](N(C=CC2=O)C(N2)=O)O[C@H](CO[P](N[C@@H](C)C(O)=O)(O)=O)[C@H]1O)[13C]([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30478.html |
| Additional Information | NULL |