Sofosbuvir metabolite GS331007 13CD3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-30476 |
| Alternative Name(s) | Sofosbuvir metabolite GS331007 13CD3;(2R)-2-Deoxy-2-fluoro-2-methyluridine-13CD3 |
| Research Area | Sofosbuvir Metabolite-13CD3;Labeled Sofosbuvir, intended for use as an internal standard for the quantification of Sofosbuvir by GC- or LC-mass spectrometry. |
| Molecular Formula | C91CH10D3FN2O5 |
| CAS# | 1256490-42-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | F[C@]1([C@H](N(C=CC2=O)C(N2)=O)O[C@H](CO)[C@H]1O)[13C]([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30476.html |
| Additional Information | NULL |