Sofosbuvir Dimer
Sofosbuvir 3',5'-Bis-(S)-phosphate is an impurity of PSI-7977, a prodrug that is metabolized to the active antiviral agent 2'-deoxy-2'-a-fluoro-ß-C-methyluridine-5'-monophosphate and is currently being investigated in phase 3 clinical trials for the treat
| Catalog Number | CS-O-11148 |
| Alternative Name(s) | (2S)-Isopropyl 2-(((((2R,3R,4R,5R)-5-(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-fluoro-2-((((R)-(((S)-1-isopropoxy-1-oxopropan-2-yl)amino)(phenoxy)phosphoryl)oxy)methyl)-4-methyltetrahydrofuran-3-yl)oxy)(phenoxy)phosphoryl)amino)propanoate; 1337482-17-3 |
| Molecular Formula | C34H45FN4O13P2 |
| CAS# | 1256490-29-5 |
| Purity | >98% |
| SMILES | O=[P](OC1=CC=CC=C1)(N[C@@H](C)C(OC(C)C)=O)O[C@@H]([C@]2(F)C)[C@H](O[C@H]2N(C=CC3=O)C(N3)=O)CO[P](OC4=CC=CC=C4)(N[C@@H](C)C(OC(C)C)=O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11148.html |
