Bepotastine D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-20037 |
| Alternative Name(s) | 4-{4-[(S)-xy]piperidin-1-yl}(2,2,3,3-D4)butanoic acid |
| Research Area | Labeled Bepotastine, intended for use as an internal standard for the quantification of Bepotastine by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H21D4ClN2O3 |
| CAS# | 125602-71-3(Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=CC=C(C=C1)[C@@H](C2=CC=CC=N2)OC3CCN(CC([2H])([2H])C([2H])([2H])C(O)=O)CC3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO20037.html |
| Additional Information | NULL |