Termitomycamide B | MedChemExpress (MCE)

Termitomycamide B (compound 2) is a neuroprotective agent that can be obtained from Termitomyces titanicus. Termitomycamide B effectively inhibits endoplasmic reticulum stress-dependent cell death. Termitomycamide B can be used in the study of neurodegenerative diseases[1][2].

Trivial name Termitomycamide B
Catalog Number HY-125603
Research Area Neurological Disease
CAS# 1254277-89-8
Purity ≥98.0%
SMILES CCCCC/C=C\C/C=C\CCCCCCCC(NCC(C(N1)=CC2=C1C=CC=C2)=O)=O
Size 1 mg
Supplier Page https://www.medchemexpress.com/termitomycamide-b.html