KS176
KS176 is a potent and selective inhibitor for the breast cancer resistance protein (BCRP) multidrug transporter with IC50s of 0.59 and 1.39 μM in Pheo A and Hoechst 33342 assays respectively.
| Trivial name | / |
| Catalog Number | CSN17368 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C22H19N3O5 |
| CAS# | 1253452-78-6 |
| Purity | ≥99% |
| SMILES | O=C(NC1=CC=C(CCO)C=C1)C2=CC=CC=C2NC(C3=CC=C([N+]([O-])=O)C=C3)=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/ks176.html |