XL388 10mM * 1mL in DMSO
XL388 is a Novel Class of Highly Potent, Selective, ATP-Competitive, and Orally Bioavailable Inhibitors of the Mammalian Target of Rapamycin (mTOR).
| Trivial name | XL388 10mM * 1mL in DMSO |
| Catalog Number | A12395-10mM-D |
| Alternative Name(s) | (7-(6-aminopyridin-3-yl)-2,3-dihydrobenzo[f][1,4]oxazepin-4(5H)-yl)(3-fluoro-2-methyl-4-(methylsulfonyl)phenyl)methanone |
| Molecular Formula | C23H22FN3O4S |
| CAS# | 1251156-08-7 |
| SMILES | CC1=C(C=CC(=C1F)S(=O)(=O)C)C(=O)N2CCOC3=C(C2)C=C(C=C3)C4=CN=C(C=C4)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/xl388.html |
