Pleuromutilin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30745 |
| Alternative Name(s) | (5R,7S,8S,9R,12R)-8-hydroxy-4,7,9,12-tetramethyl-3-oxo-7-vinyannulen-5-yl 2-hydroxycetate; Tiamulin EP Impurity G |
| Research Area | Pleuromutilin and its derivatives are antibacterial drugs that inhibit protein synthesis in bacteria by binding to the peptidyl transferase component of the 50S subunit of ribosomes. |
| Molecular Formula | C₂₂H₃₄O₅ |
| CAS# | 125-65-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]([C@@H]([C@@](C)(C[C@H]1OC(CO)=O)C=C)O)C(CC[C@H]2C)(CCC3=O)[C@]3([H])C21C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30745.html |
| Additional Information | NULL |